C14H14F3NO2 — CID 58564271
5-(trifluoromethoxy)spiro[chromene-2,4'-piperidine] (PubChem CID 58564271) has the molecular formula C14H14F3NO2 and a molecular weight of 285.26 g/mol. Its IUPAC name is 5-(trifluoromethoxy)spiro[chromene-2,4'-piperidine].
| Compound Name | 5-(trifluoromethoxy)spiro[chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 58564271 |
| Molecular Formula | C14H14F3NO2 |
| Molecular Weight | 285.26 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 5-(trifluoromethoxy)spiro[chromene-2,4'-piperidine] |
| SMILES | FC(F)(F)Oc1cccc2c1C=CC1(CCNCC1)O2 |
| InChI | InChI=1S/C14H14F3NO2/c15-14(16,17)20-12-3-1-2-11-10(12)4-5-13(19-11)6-8-18-9-7-13/h1-5,18H,6-9H2 |
| InChIKey | CFNDYBIBXBLDEN-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.26 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |