About 5-butoxy-3H-1,2-benzodioxole
5-butoxy-3H-1,2-benzodioxole (PubChem CID 88819864) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is 5-butoxy-3H-1,2-benzodioxole.
Molecular Properties
| Compound Name | 5-butoxy-3H-1,2-benzodioxole |
| PubChem CID | 88819864 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | 5-butoxy-3H-1,2-benzodioxole |
| SMILES | CCCCOc1ccc2c(c1)COO2 |
| InChI | InChI=1S/C11H14O3/c1-2-3-6-12-10-4-5-11-9(7-10)8-13-14-11/h4-5,7H,2-3,6,8H2,1H3 |
| InChIKey | FQAWFOROONDPTR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 5-butoxy-3H-1,2-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-butoxy-3H-1,2-benzodioxole?
The IUPAC name of 5-butoxy-3H-1,2-benzodioxole (CID 88819864) is 5-butoxy-3H-1,2-benzodioxole.
What is the SMILES notation for 5-butoxy-3H-1,2-benzodioxole?
The canonical SMILES for 5-butoxy-3H-1,2-benzodioxole is CCCCOc1ccc2c(c1)COO2.
What is the InChIKey of 5-butoxy-3H-1,2-benzodioxole?
The InChIKey is FQAWFOROONDPTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3/c1-2-3-6-12-10-4-5-11-9(7-10)8-13-14-11/h4-5,7H,2-3,6,8H2,1H3.
What are the key properties of 5-butoxy-3H-1,2-benzodioxole?
5-butoxy-3H-1,2-benzodioxole has a molecular weight of 194.23 g/mol, XLogP of 2.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-butoxy-3H-1,2-benzodioxole is sourced from PubChem (CID 88819864), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).