C8H5F3O5S — CID 118536244
3H-1,2-benzodioxol-5-yl trifluoromethanesulfonate (PubChem CID 118536244) has the molecular formula C8H5F3O5S and a molecular weight of 270.18 g/mol. Its IUPAC name is 3H-1,2-benzodioxol-5-yl trifluoromethanesulfonate.
| Compound Name | 3H-1,2-benzodioxol-5-yl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118536244 |
| Molecular Formula | C8H5F3O5S |
| Molecular Weight | 270.18 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 3H-1,2-benzodioxol-5-yl trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc2c(c1)COO2)C(F)(F)F |
| InChI | InChI=1S/C8H5F3O5S/c9-8(10,11)17(12,13)16-6-1-2-7-5(3-6)4-14-15-7/h1-3H,4H2 |
| InChIKey | GZPSJGYQYDKQKK-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.18 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|