C15H17F3O4S — CID 66557314
[(4Z)-5-methyl-3,6,7,8-tetrahydro-2H-1-benzoxecin-10-yl] trifluoromethanesulfonate (PubChem CID 66557314) has the molecular formula C15H17F3O4S and a molecular weight of 350.36 g/mol. Its IUPAC name is [(4Z)-5-methyl-3,6,7,8-tetrahydro-2H-1-benzoxecin-10-yl] trifluoromethanesulfonate.
| Compound Name | [(4Z)-5-methyl-3,6,7,8-tetrahydro-2H-1-benzoxecin-10-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 66557314 |
| Molecular Formula | C15H17F3O4S |
| Molecular Weight | 350.36 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | [(4Z)-5-methyl-3,6,7,8-tetrahydro-2H-1-benzoxecin-10-yl] trifluoromethanesulfonate |
| SMILES | C/C1=C/CCOc2ccc(OS(=O)(=O)C(F)(F)F)cc2CCC1 |
| InChI | InChI=1S/C15H17F3O4S/c1-11-4-2-6-12-10-13(22-23(19,20)15(16,17)18)7-8-14(12)21-9-3-5-11/h5,7-8,10H,2-4,6,9H2,1H3/b11-5- |
| InChIKey | OGMVQYFSBAXYJO-WZUFQYTHSA-N |
| XLogP | 3.97 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.36 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|