C18H30O6Si — CID 164815717
triethoxy-[3-[(2-methyl-4H-1,3-benzodioxin-6-yl)oxy]propyl]silane (PubChem CID 164815717) has the molecular formula C18H30O6Si and a molecular weight of 370.52 g/mol. Its IUPAC name is triethoxy-[3-[(2-methyl-4H-1,3-benzodioxin-6-yl)oxy]propyl]silane.
| Compound Name | triethoxy-[3-[(2-methyl-4H-1,3-benzodioxin-6-yl)oxy]propyl]silane |
|---|---|
| PubChem CID | 164815717 |
| Molecular Formula | C18H30O6Si |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | triethoxy-[3-[(2-methyl-4H-1,3-benzodioxin-6-yl)oxy]propyl]silane |
| SMILES | CCO[Si](CCCOc1ccc2c(c1)COC(C)O2)(OCC)OCC |
| InChI | InChI=1S/C18H30O6Si/c1-5-21-25(22-6-2,23-7-3)12-8-11-19-17-9-10-18-16(13-17)14-20-15(4)24-18/h9-10,13,15H,5-8,11-12,14H2,1-4H3 |
| InChIKey | WMUVJCQYEZPSFY-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|