C29H48O6Si — CID 164816332
3-[(2,2-dicyclohexyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-triethoxysilane (PubChem CID 164816332) has the molecular formula C29H48O6Si and a molecular weight of 520.78 g/mol. Its IUPAC name is 3-[(2,2-dicyclohexyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-triethoxysilane.
| Compound Name | 3-[(2,2-dicyclohexyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-triethoxysilane |
|---|---|
| PubChem CID | 164816332 |
| Molecular Formula | C29H48O6Si |
| Molecular Weight | 520.78 g/mol |
| Exact Mass | 520.32 |
| IUPAC Name | 3-[(2,2-dicyclohexyl-4H-1,3-benzodioxin-6-yl)oxy]propyl-triethoxysilane |
| SMILES | CCO[Si](CCCOc1ccc2c(c1)COC(C1CCCCC1)(C1CCCCC1)O2)(OCC)OCC |
| InChI | InChI=1S/C29H48O6Si/c1-4-32-36(33-5-2,34-6-3)21-13-20-30-27-18-19-28-24(22-27)23-31-29(35-28,25-14-9-7-10-15-25)26-16-11-8-12-17-26/h18-19,22,25-26H,4-17,20-21,23H2,1-3H3 |
| InChIKey | OBGDWBCQTQWSLM-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.78 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|