C21H36O6Si — CID 164816029
triethoxy-[(2-methyl-2-pentan-2-yl-4H-1,3-benzodioxin-6-yl)oxymethyl]silane (PubChem CID 164816029) has the molecular formula C21H36O6Si and a molecular weight of 412.60 g/mol. Its IUPAC name is triethoxy-[(2-methyl-2-pentan-2-yl-4H-1,3-benzodioxin-6-yl)oxymethyl]silane.
| Compound Name | triethoxy-[(2-methyl-2-pentan-2-yl-4H-1,3-benzodioxin-6-yl)oxymethyl]silane |
|---|---|
| PubChem CID | 164816029 |
| Molecular Formula | C21H36O6Si |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | triethoxy-[(2-methyl-2-pentan-2-yl-4H-1,3-benzodioxin-6-yl)oxymethyl]silane |
| SMILES | CCCC(C)C1(C)OCc2cc(OC[Si](OCC)(OCC)OCC)ccc2O1 |
| InChI | InChI=1S/C21H36O6Si/c1-7-11-17(5)21(6)23-15-18-14-19(12-13-20(18)27-21)22-16-28(24-8-2,25-9-3)26-10-4/h12-14,17H,7-11,15-16H2,1-6H3 |
| InChIKey | KHGDXKHUSJSOOG-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|