About 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane
4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane (PubChem CID 164816006) has the molecular formula C11H18O6Si2
and a molecular weight of 302.43 g/mol. Its IUPAC name is 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane.
Molecular Properties
| Compound Name | 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane |
| PubChem CID | 164816006 |
| Molecular Formula | C11H18O6Si2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane |
| SMILES | CO[Si](COc1ccc2c(c1)CO[SiH2]O2)(OC)OC |
| InChI | InChI=1S/C11H18O6Si2/c1-12-19(13-2,14-3)8-15-10-4-5-11-9(6-10)7-16-18-17-11/h4-6H,7-8,18H2,1-3H3 |
| InChIKey | YQYWSOLXRYWRGY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane?
The IUPAC name of 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane (CID 164816006) is 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane.
What is the SMILES notation for 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane?
The canonical SMILES for 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane is CO[Si](COc1ccc2c(c1)CO[SiH2]O2)(OC)OC.
What is the InChIKey of 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane?
The InChIKey is YQYWSOLXRYWRGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O6Si2/c1-12-19(13-2,14-3)8-15-10-4-5-11-9(6-10)7-16-18-17-11/h4-6H,7-8,18H2,1-3H3.
What are the key properties of 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane?
4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane has a molecular weight of 302.43 g/mol, XLogP of 0.39, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane is sourced from PubChem (CID 164816006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).