C11H18O6Si2 — CID 164816006
4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane (PubChem CID 164816006) has the molecular formula C11H18O6Si2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane.
| Compound Name | 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane |
|---|---|
| PubChem CID | 164816006 |
| Molecular Formula | C11H18O6Si2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | 4H-1,3,2-benzodioxasilin-6-yloxymethyl(trimethoxy)silane |
| SMILES | CO[Si](COc1ccc2c(c1)CO[SiH2]O2)(OC)OC |
| InChI | InChI=1S/C11H18O6Si2/c1-12-19(13-2,14-3)8-15-10-4-5-11-9(6-10)7-16-18-17-11/h4-6H,7-8,18H2,1-3H3 |
| InChIKey | YQYWSOLXRYWRGY-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|