C17H23ClO9Si2 — CID 164815704
[diacetyloxy-[2-[[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]oxy]ethyl]silyl] acetate (PubChem CID 164815704) has the molecular formula C17H23ClO9Si2 and a molecular weight of 462.99 g/mol. Its IUPAC name is [diacetyloxy-[2-[[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]oxy]ethyl]silyl] acetate.
| Compound Name | [diacetyloxy-[2-[[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]oxy]ethyl]silyl] acetate |
|---|---|
| PubChem CID | 164815704 |
| Molecular Formula | C17H23ClO9Si2 |
| Molecular Weight | 462.99 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | [diacetyloxy-[2-[[2-(chloromethyl)-2-methyl-4H-1,3,2-benzodioxasilin-6-yl]oxy]ethyl]silyl] acetate |
| SMILES | CC(=O)O[Si](CCOc1ccc2c(c1)CO[Si](C)(CCl)O2)(OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C17H23ClO9Si2/c1-12(19)24-29(25-13(2)20,26-14(3)21)8-7-22-16-5-6-17-15(9-16)10-23-28(4,11-18)27-17/h5-6,9H,7-8,10-11H2,1-4H3 |
| InChIKey | NDUJFENASQXAGM-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 106.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.99 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|