C19H34O5Si2 — CID 164960790
triethoxy-[2-(2-methyl-2-propyl-4H-1,3,2-benzodioxasilin-6-yl)ethyl]silane (PubChem CID 164960790) has the molecular formula C19H34O5Si2 and a molecular weight of 398.65 g/mol. Its IUPAC name is triethoxy-[2-(2-methyl-2-propyl-4H-1,3,2-benzodioxasilin-6-yl)ethyl]silane.
| Compound Name | triethoxy-[2-(2-methyl-2-propyl-4H-1,3,2-benzodioxasilin-6-yl)ethyl]silane |
|---|---|
| PubChem CID | 164960790 |
| Molecular Formula | C19H34O5Si2 |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | triethoxy-[2-(2-methyl-2-propyl-4H-1,3,2-benzodioxasilin-6-yl)ethyl]silane |
| SMILES | CCC[Si]1(C)OCc2cc(CC[Si](OCC)(OCC)OCC)ccc2O1 |
| InChI | InChI=1S/C19H34O5Si2/c1-6-13-25(5)23-16-18-15-17(10-11-19(18)24-25)12-14-26(20-7-2,21-8-3)22-9-4/h10-11,15H,6-9,12-14,16H2,1-5H3 |
| InChIKey | OBMJSOHUAZMBHD-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|