C22H41NO5Si2 — CID 164815656
N,N-dimethyl-3-[2-methyl-6-(3-triethoxysilylpropyl)-4H-1,3,2-benzodioxasilin-2-yl]propan-1-amine (PubChem CID 164815656) has the molecular formula C22H41NO5Si2 and a molecular weight of 455.74 g/mol. Its IUPAC name is N,N-dimethyl-3-[2-methyl-6-(3-triethoxysilylpropyl)-4H-1,3,2-benzodioxasilin-2-yl]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[2-methyl-6-(3-triethoxysilylpropyl)-4H-1,3,2-benzodioxasilin-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 164815656 |
| Molecular Formula | C22H41NO5Si2 |
| Molecular Weight | 455.74 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | N,N-dimethyl-3-[2-methyl-6-(3-triethoxysilylpropyl)-4H-1,3,2-benzodioxasilin-2-yl]propan-1-amine |
| SMILES | CCO[Si](CCCc1ccc2c(c1)CO[Si](C)(CCCN(C)C)O2)(OCC)OCC |
| InChI | InChI=1S/C22H41NO5Si2/c1-7-24-30(25-8-2,26-9-3)17-10-12-20-13-14-22-21(18-20)19-27-29(6,28-22)16-11-15-23(4)5/h13-14,18H,7-12,15-17,19H2,1-6H3 |
| InChIKey | YNVBADNYTQERAL-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.74 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|