C21H28O5Si — CID 164816198
trimethoxy-[3-(2-methyl-2-phenyl-4H-1,3-benzodioxin-6-yl)propyl]silane (PubChem CID 164816198) has the molecular formula C21H28O5Si and a molecular weight of 388.54 g/mol. Its IUPAC name is trimethoxy-[3-(2-methyl-2-phenyl-4H-1,3-benzodioxin-6-yl)propyl]silane.
| Compound Name | trimethoxy-[3-(2-methyl-2-phenyl-4H-1,3-benzodioxin-6-yl)propyl]silane |
|---|---|
| PubChem CID | 164816198 |
| Molecular Formula | C21H28O5Si |
| Molecular Weight | 388.54 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | trimethoxy-[3-(2-methyl-2-phenyl-4H-1,3-benzodioxin-6-yl)propyl]silane |
| SMILES | CO[Si](CCCc1ccc2c(c1)COC(C)(c1ccccc1)O2)(OC)OC |
| InChI | InChI=1S/C21H28O5Si/c1-21(19-10-6-5-7-11-19)25-16-18-15-17(12-13-20(18)26-21)9-8-14-27(22-2,23-3)24-4/h5-7,10-13,15H,8-9,14,16H2,1-4H3 |
| InChIKey | NCKMORNIDFMUBN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.54 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|