C14H22O5Si — CID 170900368
2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethyl-trimethoxysilane (PubChem CID 170900368) has the molecular formula C14H22O5Si and a molecular weight of 298.41 g/mol. Its IUPAC name is 2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethyl-trimethoxysilane.
| Compound Name | 2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethyl-trimethoxysilane |
|---|---|
| PubChem CID | 170900368 |
| Molecular Formula | C14H22O5Si |
| Molecular Weight | 298.41 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-(2,2-dimethyl-1,3-benzodioxol-5-yl)ethyl-trimethoxysilane |
| SMILES | CO[Si](CCc1ccc2c(c1)OC(C)(C)O2)(OC)OC |
| InChI | InChI=1S/C14H22O5Si/c1-14(2)18-12-7-6-11(10-13(12)19-14)8-9-20(15-3,16-4)17-5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | JTDNFTDUGRHALD-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|