C13H22O3Si — CID 59566689
2-(3,4-dimethylphenyl)ethyl-trimethoxysilane (PubChem CID 59566689) has the molecular formula C13H22O3Si and a molecular weight of 254.40 g/mol. Its IUPAC name is 2-(3,4-dimethylphenyl)ethyl-trimethoxysilane.
| Compound Name | 2-(3,4-dimethylphenyl)ethyl-trimethoxysilane |
|---|---|
| PubChem CID | 59566689 |
| Molecular Formula | C13H22O3Si |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 2-(3,4-dimethylphenyl)ethyl-trimethoxysilane |
| SMILES | CO[Si](CCc1ccc(C)c(C)c1)(OC)OC |
| InChI | InChI=1S/C13H22O3Si/c1-11-6-7-13(10-12(11)2)8-9-17(14-3,15-4)16-5/h6-7,10H,8-9H2,1-5H3 |
| InChIKey | LRPOEQZHXDYSGK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|