C19H26O5 — CID 167594575
5-(2-hydroxyethyl)-2-methoxyphenol;2-(4-methoxy-3-methylphenyl)ethanol (PubChem CID 167594575) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2-methoxyphenol;2-(4-methoxy-3-methylphenyl)ethanol.
| Compound Name | 5-(2-hydroxyethyl)-2-methoxyphenol;2-(4-methoxy-3-methylphenyl)ethanol |
|---|---|
| PubChem CID | 167594575 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | 5-(2-hydroxyethyl)-2-methoxyphenol;2-(4-methoxy-3-methylphenyl)ethanol |
| SMILES | COc1ccc(CCO)cc1C.COc1ccc(CCO)cc1O |
| InChI | InChI=1S/C10H14O2.C9H12O3/c1-8-7-9(5-6-11)3-4-10(8)12-2;1-12-9-3-2-7(4-5-10)6-8(9)11/h3-4,7,11H,5-6H2,1-2H3;2-3,6,10-11H,4-5H2,1H3 |
| InChIKey | IWOXVKQDYHCICM-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |