C17H21NO2 — CID 39370195
2-methoxy-5-[(2,4,6-trimethylanilino)methyl]phenol (PubChem CID 39370195) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is 2-methoxy-5-[(2,4,6-trimethylanilino)methyl]phenol.
| Compound Name | 2-methoxy-5-[(2,4,6-trimethylanilino)methyl]phenol |
|---|---|
| PubChem CID | 39370195 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | 2-methoxy-5-[(2,4,6-trimethylanilino)methyl]phenol |
| SMILES | COc1ccc(CNc2c(C)cc(C)cc2C)cc1O |
| InChI | InChI=1S/C17H21NO2/c1-11-7-12(2)17(13(3)8-11)18-10-14-5-6-16(20-4)15(19)9-14/h5-9,18-19H,10H2,1-4H3 |
| InChIKey | AJOGTSSYEZSUFO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |