C15H15Cl2NO2 — CID 104726290
5-[(2,5-dichloro-4-methylanilino)methyl]-2-methoxyphenol (PubChem CID 104726290) has the molecular formula C15H15Cl2NO2 and a molecular weight of 312.20 g/mol. Its IUPAC name is 5-[(2,5-dichloro-4-methylanilino)methyl]-2-methoxyphenol.
| Compound Name | 5-[(2,5-dichloro-4-methylanilino)methyl]-2-methoxyphenol |
|---|---|
| PubChem CID | 104726290 |
| Molecular Formula | C15H15Cl2NO2 |
| Molecular Weight | 312.20 g/mol |
| Exact Mass | 311.05 |
| IUPAC Name | 5-[(2,5-dichloro-4-methylanilino)methyl]-2-methoxyphenol |
| SMILES | COc1ccc(CNc2cc(Cl)c(C)cc2Cl)cc1O |
| InChI | InChI=1S/C15H15Cl2NO2/c1-9-5-12(17)13(7-11(9)16)18-8-10-3-4-15(20-2)14(19)6-10/h3-7,18-19H,8H2,1-2H3 |
| InChIKey | LRONKTYOUHBRPG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.20 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |