C14H16O3 — CID 12849270
2-(6,7-dimethoxynaphthalen-2-yl)ethanol (PubChem CID 12849270) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is 2-(6,7-dimethoxynaphthalen-2-yl)ethanol.
| Compound Name | 2-(6,7-dimethoxynaphthalen-2-yl)ethanol |
|---|---|
| PubChem CID | 12849270 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | 2-(6,7-dimethoxynaphthalen-2-yl)ethanol |
| SMILES | COc1cc2ccc(CCO)cc2cc1OC |
| InChI | InChI=1S/C14H16O3/c1-16-13-8-11-4-3-10(5-6-15)7-12(11)9-14(13)17-2/h3-4,7-9,15H,5-6H2,1-2H3 |
| InChIKey | FVVYYCOYSWVTPD-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |