C20H28ClNO2 — CID 88752703
1-(6,7-dimethoxynaphthalen-2-yl)octan-3-imine;hydrochloride (PubChem CID 88752703) has the molecular formula C20H28ClNO2 and a molecular weight of 349.90 g/mol. Its IUPAC name is 1-(6,7-dimethoxynaphthalen-2-yl)octan-3-imine;hydrochloride.
| Compound Name | 1-(6,7-dimethoxynaphthalen-2-yl)octan-3-imine;hydrochloride |
|---|---|
| PubChem CID | 88752703 |
| Molecular Formula | C20H28ClNO2 |
| Molecular Weight | 349.90 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-(6,7-dimethoxynaphthalen-2-yl)octan-3-imine;hydrochloride |
| SMILES | Cl.[H]/N=C(\CCCCC)CCc1ccc2cc(OC)c(OC)cc2c1 |
| InChI | InChI=1S/C20H27NO2.ClH/c1-4-5-6-7-18(21)11-9-15-8-10-16-13-19(22-2)20(23-3)14-17(16)12-15;/h8,10,12-14,21H,4-7,9,11H2,1-3H3;1H/b21-18+; |
| InChIKey | UCHXVNHFXLOVPB-GOSREXKOSA-N |
| XLogP | 5.81 |
| TPSA | 42.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.90 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|