C12H17NO3 — CID 95445563
methyl 3-(3,4-dimethoxyphenyl)propanimidate (PubChem CID 95445563) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is methyl 3-(3,4-dimethoxyphenyl)propanimidate.
| Compound Name | methyl 3-(3,4-dimethoxyphenyl)propanimidate |
|---|---|
| PubChem CID | 95445563 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | methyl 3-(3,4-dimethoxyphenyl)propanimidate |
| SMILES | [H]/N=C(/CCc1ccc(OC)c(OC)c1)OC |
| InChI | InChI=1S/C12H17NO3/c1-14-10-6-4-9(8-11(10)15-2)5-7-12(13)16-3/h4,6,8,13H,5,7H2,1-3H3/b13-12- |
| InChIKey | VPPXROZFWGXTQB-SEYXRHQNSA-N |
| XLogP | 2.26 |
| TPSA | 51.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|