C13H18N2O3 — CID 143846956
2-(3,4-dimethoxyphenyl)ethyl (NE)-N-ethylidenecarbamimidate (PubChem CID 143846956) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)ethyl (NE)-N-ethylidenecarbamimidate.
| Compound Name | 2-(3,4-dimethoxyphenyl)ethyl (NE)-N-ethylidenecarbamimidate |
|---|---|
| PubChem CID | 143846956 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)ethyl (NE)-N-ethylidenecarbamimidate |
| SMILES | [H]/N=C(\N=C\C)OCCc1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C13H18N2O3/c1-4-15-13(14)18-8-7-10-5-6-11(16-2)12(9-10)17-3/h4-6,9,14H,7-8H2,1-3H3/b14-13+,15-4+ |
| InChIKey | SZJPFCXPTVSARG-WIYWYVSVSA-N |
| XLogP | 2.29 |
| TPSA | 63.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|