C12H15NO5 — CID 175344538
formamido 3-(3,4-dimethoxyphenyl)propanoate (PubChem CID 175344538) has the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. Its IUPAC name is formamido 3-(3,4-dimethoxyphenyl)propanoate.
| Compound Name | formamido 3-(3,4-dimethoxyphenyl)propanoate |
|---|---|
| PubChem CID | 175344538 |
| Molecular Formula | C12H15NO5 |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.10 |
| IUPAC Name | formamido 3-(3,4-dimethoxyphenyl)propanoate |
| SMILES | COc1ccc(CCC(=O)ONC=O)cc1OC |
| InChI | InChI=1S/C12H15NO5/c1-16-10-5-3-9(7-11(10)17-2)4-6-12(15)18-13-8-14/h3,5,7-8H,4,6H2,1-2H3,(H,13,14) |
| InChIKey | RPRQOMJROUOTKY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|