C14H15ClO2 — CID 20541850
6-(2-chloroethyl)-2,3-dimethoxynaphthalene (PubChem CID 20541850) has the molecular formula C14H15ClO2 and a molecular weight of 250.72 g/mol. Its IUPAC name is 6-(2-chloroethyl)-2,3-dimethoxynaphthalene.
| Compound Name | 6-(2-chloroethyl)-2,3-dimethoxynaphthalene |
|---|---|
| PubChem CID | 20541850 |
| Molecular Formula | C14H15ClO2 |
| Molecular Weight | 250.72 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 6-(2-chloroethyl)-2,3-dimethoxynaphthalene |
| SMILES | COc1cc2ccc(CCCl)cc2cc1OC |
| InChI | InChI=1S/C14H15ClO2/c1-16-13-8-11-4-3-10(5-6-15)7-12(11)9-14(13)17-2/h3-4,7-9H,5-6H2,1-2H3 |
| InChIKey | WHDRYNCLEFUFIW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.72 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|