C16H20O3 — CID 150686406
2-[6,7-bis(2-hydroxyethyl)naphthalen-2-yl]ethanol (PubChem CID 150686406) has the molecular formula C16H20O3 and a molecular weight of 260.33 g/mol. Its IUPAC name is 2-[6,7-bis(2-hydroxyethyl)naphthalen-2-yl]ethanol.
| Compound Name | 2-[6,7-bis(2-hydroxyethyl)naphthalen-2-yl]ethanol |
|---|---|
| PubChem CID | 150686406 |
| Molecular Formula | C16H20O3 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.14 |
| IUPAC Name | 2-[6,7-bis(2-hydroxyethyl)naphthalen-2-yl]ethanol |
| SMILES | OCCc1ccc2cc(CCO)c(CCO)cc2c1 |
| InChI | InChI=1S/C16H20O3/c17-6-3-12-1-2-13-10-14(4-7-18)15(5-8-19)11-16(13)9-12/h1-2,9-11,17-19H,3-8H2 |
| InChIKey | JIYLUTACYDTCIE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |