About 2-chrysen-2-ylethanol
2-chrysen-2-ylethanol (PubChem CID 87369474) has the molecular formula C20H16O
and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-chrysen-2-ylethanol.
Molecular Properties
| Compound Name | 2-chrysen-2-ylethanol |
| PubChem CID | 87369474 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-chrysen-2-ylethanol |
| SMILES | OCCc1ccc2c(ccc3c4ccccc4ccc23)c1 |
| InChI | InChI=1S/C20H16O/c21-12-11-14-5-8-18-16(13-14)7-10-19-17-4-2-1-3-15(17)6-9-20(18)19/h1-10,13,21H,11-12H2 |
| InChIKey | BPROORYZJNCDSA-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-chrysen-2-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chrysen-2-ylethanol?
The IUPAC name of 2-chrysen-2-ylethanol (CID 87369474) is 2-chrysen-2-ylethanol.
What is the SMILES notation for 2-chrysen-2-ylethanol?
The canonical SMILES for 2-chrysen-2-ylethanol is OCCc1ccc2c(ccc3c4ccccc4ccc23)c1.
What is the InChIKey of 2-chrysen-2-ylethanol?
The InChIKey is BPROORYZJNCDSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16O/c21-12-11-14-5-8-18-16(13-14)7-10-19-17-4-2-1-3-15(17)6-9-20(18)19/h1-10,13,21H,11-12H2.
What are the key properties of 2-chrysen-2-ylethanol?
2-chrysen-2-ylethanol has a molecular weight of 272.35 g/mol, XLogP of 4.68, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chrysen-2-ylethanol is sourced from PubChem (CID 87369474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).