C20H16O — CID 87369966
2-chrysen-5-ylethanol (PubChem CID 87369966) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is 2-chrysen-5-ylethanol.
| Compound Name | 2-chrysen-5-ylethanol |
|---|---|
| PubChem CID | 87369966 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 2-chrysen-5-ylethanol |
| SMILES | OCCc1cc2ccccc2c2ccc3ccccc3c12 |
| InChI | InChI=1S/C20H16O/c21-12-11-16-13-15-6-2-3-7-17(15)19-10-9-14-5-1-4-8-18(14)20(16)19/h1-10,13,21H,11-12H2 |
| InChIKey | AZOGRMVLPKJLCP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|