About ethane;2-naphthalen-1-ylethanol
ethane;2-naphthalen-1-ylethanol (PubChem CID 145119048) has the molecular formula C16H24O
and a molecular weight of 232.37 g/mol. Its IUPAC name is ethane;2-naphthalen-1-ylethanol.
Molecular Properties
| Compound Name | ethane;2-naphthalen-1-ylethanol |
| PubChem CID | 145119048 |
| Molecular Formula | C16H24O |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.18 |
| IUPAC Name | ethane;2-naphthalen-1-ylethanol |
| SMILES | CC.CC.OCCc1cccc2ccccc12 |
| InChI | InChI=1S/C12H12O.2C2H6/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11;2*1-2/h1-7,13H,8-9H2;2*1-2H3 |
| InChIKey | SZLRVGGDIIRQHA-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-naphthalen-1-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-naphthalen-1-ylethanol?
The IUPAC name of ethane;2-naphthalen-1-ylethanol (CID 145119048) is ethane;2-naphthalen-1-ylethanol.
What is the SMILES notation for ethane;2-naphthalen-1-ylethanol?
The canonical SMILES for ethane;2-naphthalen-1-ylethanol is CC.CC.OCCc1cccc2ccccc12.
What is the InChIKey of ethane;2-naphthalen-1-ylethanol?
The InChIKey is SZLRVGGDIIRQHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O.2C2H6/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11;2*1-2/h1-7,13H,8-9H2;2*1-2H3.
What are the key properties of ethane;2-naphthalen-1-ylethanol?
ethane;2-naphthalen-1-ylethanol has a molecular weight of 232.37 g/mol, XLogP of 4.43, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-naphthalen-1-ylethanol is sourced from PubChem (CID 145119048), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).