About 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol
2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol (PubChem CID 22072995) has the molecular formula C24H24O2
and a molecular weight of 344.45 g/mol. Its IUPAC name is 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol.
Molecular Properties
| Compound Name | 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol |
| PubChem CID | 22072995 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol |
| SMILES | OCCc1ccc2ccccc2c1.OCCc1cccc2ccccc12 |
| InChI | InChI=1S/2C12H12O/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11;13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-7,13H,8-9H2;1-6,9,13H,7-8H2 |
| InChIKey | UUECDLLDNYRGIJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol?
The IUPAC name of 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol (CID 22072995) is 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol.
What is the SMILES notation for 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol?
The canonical SMILES for 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol is OCCc1ccc2ccccc2c1.OCCc1cccc2ccccc12.
What is the InChIKey of 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol?
The InChIKey is UUECDLLDNYRGIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C12H12O/c13-9-8-11-6-3-5-10-4-1-2-7-12(10)11;13-8-7-10-5-6-11-3-1-2-4-12(11)9-10/h1-7,13H,8-9H2;1-6,9,13H,7-8H2.
What are the key properties of 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol?
2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol has a molecular weight of 344.45 g/mol, XLogP of 4.75, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-ylethanol;2-naphthalen-2-ylethanol is sourced from PubChem (CID 22072995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).