C35H32O5 — CID 138543173
3-naphthalen-2-ylpropanoic acid;3-naphthalen-1-ylpropanoyl 3-phenylpropanoate (PubChem CID 138543173) has the molecular formula C35H32O5 and a molecular weight of 532.64 g/mol. Its IUPAC name is 3-naphthalen-2-ylpropanoic acid;3-naphthalen-1-ylpropanoyl 3-phenylpropanoate.
| Compound Name | 3-naphthalen-2-ylpropanoic acid;3-naphthalen-1-ylpropanoyl 3-phenylpropanoate |
|---|---|
| PubChem CID | 138543173 |
| Molecular Formula | C35H32O5 |
| Molecular Weight | 532.64 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | 3-naphthalen-2-ylpropanoic acid;3-naphthalen-1-ylpropanoyl 3-phenylpropanoate |
| SMILES | O=C(CCc1ccccc1)OC(=O)CCc1cccc2ccccc12.O=C(O)CCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H20O3.C13H12O2/c23-21(15-13-17-7-2-1-3-8-17)25-22(24)16-14-19-11-6-10-18-9-4-5-12-20(18)19;14-13(15)8-6-10-5-7-11-3-1-2-4-12(11)9-10/h1-12H,13-16H2;1-5,7,9H,6,8H2,(H,14,15) |
| InChIKey | UKPQERAKCZYRHF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.64 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|