C24H27NO5 — CID 142868295
methanol;3-[4-[2-[methyl(naphthalen-1-ylmethyl)amino]-2-oxoethoxy]phenyl]propanoic acid (PubChem CID 142868295) has the molecular formula C24H27NO5 and a molecular weight of 409.48 g/mol. Its IUPAC name is methanol;3-[4-[2-[methyl(naphthalen-1-ylmethyl)amino]-2-oxoethoxy]phenyl]propanoic acid.
| Compound Name | methanol;3-[4-[2-[methyl(naphthalen-1-ylmethyl)amino]-2-oxoethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 142868295 |
| Molecular Formula | C24H27NO5 |
| Molecular Weight | 409.48 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | methanol;3-[4-[2-[methyl(naphthalen-1-ylmethyl)amino]-2-oxoethoxy]phenyl]propanoic acid |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)COc1ccc(CCC(=O)O)cc1.CO |
| InChI | InChI=1S/C23H23NO4.CH4O/c1-24(15-19-7-4-6-18-5-2-3-8-21(18)19)22(25)16-28-20-12-9-17(10-13-20)11-14-23(26)27;1-2/h2-10,12-13H,11,14-16H2,1H3,(H,26,27);2H,1H3 |
| InChIKey | UFZNMMUCLSODPY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.48 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |