C16H19NO2 — CID 115163076
4-hydroxy-N-methyl-N-(naphthalen-1-ylmethyl)butanamide (PubChem CID 115163076) has the molecular formula C16H19NO2 and a molecular weight of 257.33 g/mol. Its IUPAC name is 4-hydroxy-N-methyl-N-(naphthalen-1-ylmethyl)butanamide.
| Compound Name | 4-hydroxy-N-methyl-N-(naphthalen-1-ylmethyl)butanamide |
|---|---|
| PubChem CID | 115163076 |
| Molecular Formula | C16H19NO2 |
| Molecular Weight | 257.33 g/mol |
| Exact Mass | 257.14 |
| IUPAC Name | 4-hydroxy-N-methyl-N-(naphthalen-1-ylmethyl)butanamide |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)CCCO |
| InChI | InChI=1S/C16H19NO2/c1-17(16(19)10-5-11-18)12-14-8-4-7-13-6-2-3-9-15(13)14/h2-4,6-9,18H,5,10-12H2,1H3 |
| InChIKey | WHIBPNAWHNVAOY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.33 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |