C26H34N2O2 — CID 66794984
5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-methyl-N-(naphthalen-1-ylmethyl)-5-oxopentanamide (PubChem CID 66794984) has the molecular formula C26H34N2O2 and a molecular weight of 406.57 g/mol. Its IUPAC name is 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-methyl-N-(naphthalen-1-ylmethyl)-5-oxopentanamide.
| Compound Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-methyl-N-(naphthalen-1-ylmethyl)-5-oxopentanamide |
|---|---|
| PubChem CID | 66794984 |
| Molecular Formula | C26H34N2O2 |
| Molecular Weight | 406.57 g/mol |
| Exact Mass | 406.26 |
| IUPAC Name | 5-(3,4,4a,5,6,7,8,8a-octahydro-2H-quinolin-1-yl)-N-methyl-N-(naphthalen-1-ylmethyl)-5-oxopentanamide |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)CCCC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C26H34N2O2/c1-27(19-22-12-6-11-20-9-2-4-14-23(20)22)25(29)16-7-17-26(30)28-18-8-13-21-10-3-5-15-24(21)28/h2,4,6,9,11-12,14,21,24H,3,5,7-8,10,13,15-19H2,1H3 |
| InChIKey | IQXCCIUVVMXGCX-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |