C26H35N3O2 — CID 66795023
N-[4-[methyl(naphthalen-1-ylmethyl)amino]-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide (PubChem CID 66795023) has the molecular formula C26H35N3O2 and a molecular weight of 421.59 g/mol. Its IUPAC name is N-[4-[methyl(naphthalen-1-ylmethyl)amino]-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide.
| Compound Name | N-[4-[methyl(naphthalen-1-ylmethyl)amino]-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide |
|---|---|
| PubChem CID | 66795023 |
| Molecular Formula | C26H35N3O2 |
| Molecular Weight | 421.59 g/mol |
| Exact Mass | 421.27 |
| IUPAC Name | N-[4-[methyl(naphthalen-1-ylmethyl)amino]-4-oxobutyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-1-carboxamide |
| SMILES | CN(Cc1cccc2ccccc12)C(=O)CCCNC(=O)N1CCCC2CCCCC21 |
| InChI | InChI=1S/C26H35N3O2/c1-28(19-22-12-6-11-20-9-2-4-14-23(20)22)25(30)16-7-17-27-26(31)29-18-8-13-21-10-3-5-15-24(21)29/h2,4,6,9,11-12,14,21,24H,3,5,7-8,10,13,15-19H2,1H3,(H,27,31) |
| InChIKey | UMNPSYKABULCPL-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.59 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|