C14H15NO2 — CID 115139108
3-hydroxy-N-(naphthalen-2-ylmethyl)propanamide (PubChem CID 115139108) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-hydroxy-N-(naphthalen-2-ylmethyl)propanamide.
| Compound Name | 3-hydroxy-N-(naphthalen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 115139108 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-hydroxy-N-(naphthalen-2-ylmethyl)propanamide |
| SMILES | O=C(CCO)NCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C14H15NO2/c16-8-7-14(17)15-10-11-5-6-12-3-1-2-4-13(12)9-11/h1-6,9,16H,7-8,10H2,(H,15,17) |
| InChIKey | SWRCYDBMTAWSDA-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |