C19H20N2O3S — CID 14458004
4-[(4R)-4-formyl-1,3-thiazolidin-3-yl]-N-(naphthalen-2-ylmethyl)-4-oxobutanamide (PubChem CID 14458004) has the molecular formula C19H20N2O3S and a molecular weight of 356.45 g/mol. Its IUPAC name is 4-[(4R)-4-formyl-1,3-thiazolidin-3-yl]-N-(naphthalen-2-ylmethyl)-4-oxobutanamide.
| Compound Name | 4-[(4R)-4-formyl-1,3-thiazolidin-3-yl]-N-(naphthalen-2-ylmethyl)-4-oxobutanamide |
|---|---|
| PubChem CID | 14458004 |
| Molecular Formula | C19H20N2O3S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.12 |
| IUPAC Name | 4-[(4R)-4-formyl-1,3-thiazolidin-3-yl]-N-(naphthalen-2-ylmethyl)-4-oxobutanamide |
| SMILES | O=C[C@@H]1CSCN1C(=O)CCC(=O)NCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C19H20N2O3S/c22-11-17-12-25-13-21(17)19(24)8-7-18(23)20-10-14-5-6-15-3-1-2-4-16(15)9-14/h1-6,9,11,17H,7-8,10,12-13H2,(H,20,23)/t17-/m1/s1 |
| InChIKey | OLBPIMYERXOGEP-QGZVFWFLSA-N |
| XLogP | 2.34 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|