C23H25NO3S — CID 14457954
(4R)-3-[(E)-3-[4-(4-phenylbutoxy)phenyl]prop-2-enoyl]-1,3-thiazolidine-4-carbaldehyde (PubChem CID 14457954) has the molecular formula C23H25NO3S and a molecular weight of 395.52 g/mol. Its IUPAC name is (4R)-3-[(E)-3-[4-(4-phenylbutoxy)phenyl]prop-2-enoyl]-1,3-thiazolidine-4-carbaldehyde.
| Compound Name | (4R)-3-[(E)-3-[4-(4-phenylbutoxy)phenyl]prop-2-enoyl]-1,3-thiazolidine-4-carbaldehyde |
|---|---|
| PubChem CID | 14457954 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | (4R)-3-[(E)-3-[4-(4-phenylbutoxy)phenyl]prop-2-enoyl]-1,3-thiazolidine-4-carbaldehyde |
| SMILES | O=C[C@@H]1CSCN1C(=O)/C=C/c1ccc(OCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H25NO3S/c25-16-21-17-28-18-24(21)23(26)14-11-20-9-12-22(13-10-20)27-15-5-4-8-19-6-2-1-3-7-19/h1-3,6-7,9-14,16,21H,4-5,8,15,17-18H2/b14-11+/t21-/m1/s1 |
| InChIKey | RJFPEWMFHBPLGK-QGFLDLQWSA-N |
| XLogP | 4.20 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|