C27H30O4 — CID 175055126
1,1'-biphenyl;3-[4-(6-hydroxyhexoxy)phenyl]prop-2-enoic acid (PubChem CID 175055126) has the molecular formula C27H30O4 and a molecular weight of 418.53 g/mol. Its IUPAC name is 1,1'-biphenyl;3-[4-(6-hydroxyhexoxy)phenyl]prop-2-enoic acid.
| Compound Name | 1,1'-biphenyl;3-[4-(6-hydroxyhexoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175055126 |
| Molecular Formula | C27H30O4 |
| Molecular Weight | 418.53 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 1,1'-biphenyl;3-[4-(6-hydroxyhexoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc(OCCCCCCO)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H20O4.C12H10/c16-11-3-1-2-4-12-19-14-8-5-13(6-9-14)7-10-15(17)18;1-3-7-11(8-4-1)12-9-5-2-6-10-12/h5-10,16H,1-4,11-12H2,(H,17,18);1-10H |
| InChIKey | BYCYGPQJGNZNQY-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.53 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|