C23H22O4 — CID 175052952
1,1'-biphenyl;(E)-3-[4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid (PubChem CID 175052952) has the molecular formula C23H22O4 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1,1'-biphenyl;(E)-3-[4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 1,1'-biphenyl;(E)-3-[4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 175052952 |
| Molecular Formula | C23H22O4 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 1,1'-biphenyl;(E)-3-[4-(2-hydroxyethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OCCO)cc1.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C11H12O4/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;12-7-8-15-10-4-1-9(2-5-10)3-6-11(13)14/h1-10H;1-6,12H,7-8H2,(H,13,14)/b;6-3+ |
| InChIKey | RXMXTGPJLDPLHM-GNRCENTLSA-N |
| XLogP | 4.51 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|