C30H26O3 — CID 67569703
(E)-3-[4-(3,3,3-triphenylpropoxy)phenyl]prop-2-enoic acid (PubChem CID 67569703) has the molecular formula C30H26O3 and a molecular weight of 434.54 g/mol. Its IUPAC name is (E)-3-[4-(3,3,3-triphenylpropoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(3,3,3-triphenylpropoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 67569703 |
| Molecular Formula | C30H26O3 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.19 |
| IUPAC Name | (E)-3-[4-(3,3,3-triphenylpropoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(OCCC(c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C30H26O3/c31-29(32)21-18-24-16-19-28(20-17-24)33-23-22-30(25-10-4-1-5-11-25,26-12-6-2-7-13-26)27-14-8-3-9-15-27/h1-21H,22-23H2,(H,31,32)/b21-18+ |
| InChIKey | WVODOUNYLFJUIS-DYTRJAOYSA-N |
| XLogP | 6.59 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|