About (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate
(2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate (PubChem CID 141374619) has the molecular formula C25H24O4
and a molecular weight of 388.46 g/mol. Its IUPAC name is (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate |
| PubChem CID | 141374619 |
| Molecular Formula | C25H24O4 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.17 |
| IUPAC Name | (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate |
| SMILES | O=C(C=Cc1ccc(OCCCCO)cc1)Oc1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C25H24O4/c26-18-6-7-19-28-22-15-12-20(13-16-22)14-17-25(27)29-24-11-5-4-10-23(24)21-8-2-1-3-9-21/h1-5,8-17,26H,6-7,18-19H2 |
| InChIKey | LSXRJKMLJFRXKG-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate?
The IUPAC name of (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate (CID 141374619) is (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate.
What is the SMILES notation for (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate?
The canonical SMILES for (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate is O=C(C=Cc1ccc(OCCCCO)cc1)Oc1ccccc1-c1ccccc1.
What is the InChIKey of (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate?
The InChIKey is LSXRJKMLJFRXKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H24O4/c26-18-6-7-19-28-22-15-12-20(13-16-22)14-17-25(27)29-24-11-5-4-10-23(24)21-8-2-1-3-9-21/h1-5,8-17,26H,6-7,18-19H2.
What are the key properties of (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate?
(2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate has a molecular weight of 388.46 g/mol, XLogP of 5.12, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylphenyl) 3-[4-(4-hydroxybutoxy)phenyl]prop-2-enoate is sourced from PubChem (CID 141374619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).