C23H27NO3 — CID 23121598
1-[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enyl]aziridine-2-carboxylic acid (PubChem CID 23121598) has the molecular formula C23H27NO3 and a molecular weight of 365.47 g/mol. Its IUPAC name is 1-[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enyl]aziridine-2-carboxylic acid.
| Compound Name | 1-[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enyl]aziridine-2-carboxylic acid |
|---|---|
| PubChem CID | 23121598 |
| Molecular Formula | C23H27NO3 |
| Molecular Weight | 365.47 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | 1-[(E)-3-[4-(5-phenylpentoxy)phenyl]prop-2-enyl]aziridine-2-carboxylic acid |
| SMILES | O=C(O)C1CN1C/C=C/c1ccc(OCCCCCc2ccccc2)cc1 |
| InChI | InChI=1S/C23H27NO3/c25-23(26)22-18-24(22)16-7-11-20-12-14-21(15-13-20)27-17-6-2-5-10-19-8-3-1-4-9-19/h1,3-4,7-9,11-15,22H,2,5-6,10,16-18H2,(H,25,26)/b11-7+ |
| InChIKey | LLEPUERDUNKSIX-YRNVUSSQSA-N |
| XLogP | 4.26 |
| TPSA | 49.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.47 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|