C17H19NO2S — CID 156702494
(4S)-4-methyl-5-(naphthalen-2-ylmethylamino)-5-oxopentanethioic S-acid (PubChem CID 156702494) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (4S)-4-methyl-5-(naphthalen-2-ylmethylamino)-5-oxopentanethioic S-acid.
| Compound Name | (4S)-4-methyl-5-(naphthalen-2-ylmethylamino)-5-oxopentanethioic S-acid |
|---|---|
| PubChem CID | 156702494 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (4S)-4-methyl-5-(naphthalen-2-ylmethylamino)-5-oxopentanethioic S-acid |
| SMILES | C[C@@H](CCC(=O)S)C(=O)NCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C17H19NO2S/c1-12(6-9-16(19)21)17(20)18-11-13-7-8-14-4-2-3-5-15(14)10-13/h2-5,7-8,10,12H,6,9,11H2,1H3,(H,18,20)(H,19,21)/t12-/m0/s1 |
| InChIKey | NKNFUMGMMSRSMI-LBPRGKRZSA-N |
| XLogP | 3.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|