C22H27N3O4 — CID 59763523
(3R)-3-N-ethyl-2-N-[(2S)-1-(naphthalen-2-ylmethylamino)-1-oxopentan-2-yl]oxirane-2,3-dicarboxamide (PubChem CID 59763523) has the molecular formula C22H27N3O4 and a molecular weight of 397.48 g/mol. Its IUPAC name is (3R)-3-N-ethyl-2-N-[(2S)-1-(naphthalen-2-ylmethylamino)-1-oxopentan-2-yl]oxirane-2,3-dicarboxamide.
| Compound Name | (3R)-3-N-ethyl-2-N-[(2S)-1-(naphthalen-2-ylmethylamino)-1-oxopentan-2-yl]oxirane-2,3-dicarboxamide |
|---|---|
| PubChem CID | 59763523 |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.20 |
| IUPAC Name | (3R)-3-N-ethyl-2-N-[(2S)-1-(naphthalen-2-ylmethylamino)-1-oxopentan-2-yl]oxirane-2,3-dicarboxamide |
| SMILES | CCC[C@H](NC(=O)C1O[C@H]1C(=O)NCC)C(=O)NCc1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H27N3O4/c1-3-7-17(25-22(28)19-18(29-19)21(27)23-4-2)20(26)24-13-14-10-11-15-8-5-6-9-16(15)12-14/h5-6,8-12,17-19H,3-4,7,13H2,1-2H3,(H,23,27)(H,24,26)(H,25,28)/t17-,18+,19?/m0/s1 |
| InChIKey | OONWFYXCLVGHKZ-PAMZHZACSA-N |
| XLogP | 1.64 |
| TPSA | 99.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|