C17H10O — CID 141367882
6-pentacyclo[6.6.2.02,7.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaenylmethanol (PubChem CID 141367882) has the molecular formula C17H10O and a molecular weight of 230.27 g/mol. Its IUPAC name is 6-pentacyclo[6.6.2.02,7.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaenylmethanol.
| Compound Name | 6-pentacyclo[6.6.2.02,7.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaenylmethanol |
|---|---|
| PubChem CID | 141367882 |
| Molecular Formula | C17H10O |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | 6-pentacyclo[6.6.2.02,7.04,16.011,15]hexadeca-1(14),2,4,6,8(16),9,11(15),12-octaenylmethanol |
| SMILES | OCc1cc2cc3c4cccc5ccc(c13)c2c54 |
| InChI | InChI=1S/C17H10O/c18-8-11-6-10-7-14-12-3-1-2-9-4-5-13(15(11)14)17(10)16(9)12/h1-7,18H,8H2 |
| InChIKey | AVBBFSQFNXNCAE-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|