6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid

C15H20O4 — CID 118649631

IUPAC6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid
SMILESCC1(C)Oc2ccc(CCCCCC(=O)O)cc2O1
InChIInChI=1S/C15H20O4/c1-15(2)18-12-9-8-11(10-13(12)19-15)6-4-3-5-7-14(16)17/h8-10H,3-7H2,1-2H3,(H,16,17)
InChIKeyNMYQNJXRMDGYAO-UHFFFAOYSA-N
MW264.32 g/mol
LogP3.38
Rot. Bonds6

About 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid

6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid (PubChem CID 118649631) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid.

Molecular Properties

Compound Name6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid
PubChem CID118649631
Molecular FormulaC15H20O4
Molecular Weight264.32 g/mol
Exact Mass264.14
IUPAC Name6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid
SMILESCC1(C)Oc2ccc(CCCCCC(=O)O)cc2O1
InChIInChI=1S/C15H20O4/c1-15(2)18-12-9-8-11(10-13(12)19-15)6-4-3-5-7-14(16)17/h8-10H,3-7H2,1-2H3,(H,16,17)
InChIKeyNMYQNJXRMDGYAO-UHFFFAOYSA-N
XLogP3.38
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500264.32
LogP ≤ 53.38
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid?
The IUPAC name of 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid (CID 118649631) is 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid.
What is the SMILES notation for 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid?
The canonical SMILES for 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid is CC1(C)Oc2ccc(CCCCCC(=O)O)cc2O1.
What is the InChIKey of 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid?
The InChIKey is NMYQNJXRMDGYAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O4/c1-15(2)18-12-9-8-11(10-13(12)19-15)6-4-3-5-7-14(16)17/h8-10H,3-7H2,1-2H3,(H,16,17).
What are the key properties of 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid?
6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid has a molecular weight of 264.32 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,2-dimethyl-1,3-benzodioxol-5-yl)hexanoic acid is sourced from PubChem (CID 118649631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).