C19H28O2 — CID 10017002
5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pentanoic acid (PubChem CID 10017002) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pentanoic acid.
| Compound Name | 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 10017002 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | 5-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)pentanoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(CCCCC(=O)O)ccc21 |
| InChI | InChI=1S/C19H28O2/c1-18(2)11-12-19(3,4)16-13-14(9-10-15(16)18)7-5-6-8-17(20)21/h9-10,13H,5-8,11-12H2,1-4H3,(H,20,21) |
| InChIKey | WVMRPODECJPUON-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|