C9H9FO2 — CID 18966282
5-fluoro-2,2-dimethyl-1,3-benzodioxole (PubChem CID 18966282) has the molecular formula C9H9FO2 and a molecular weight of 168.17 g/mol. Its IUPAC name is 5-fluoro-2,2-dimethyl-1,3-benzodioxole.
| Compound Name | 5-fluoro-2,2-dimethyl-1,3-benzodioxole |
|---|---|
| PubChem CID | 18966282 |
| Molecular Formula | C9H9FO2 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.06 |
| IUPAC Name | 5-fluoro-2,2-dimethyl-1,3-benzodioxole |
| SMILES | CC1(C)Oc2ccc(F)cc2O1 |
| InChI | InChI=1S/C9H9FO2/c1-9(2)11-7-4-3-6(10)5-8(7)12-9/h3-5H,1-2H3 |
| InChIKey | YRBMKKTXTVYSAW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |