C13H19FO — CID 143131950
ethane;6-fluoro-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 143131950) has the molecular formula C13H19FO and a molecular weight of 210.29 g/mol. Its IUPAC name is ethane;6-fluoro-2,2-dimethyl-3,4-dihydrochromene.
| Compound Name | ethane;6-fluoro-2,2-dimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 143131950 |
| Molecular Formula | C13H19FO |
| Molecular Weight | 210.29 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | ethane;6-fluoro-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | CC.CC1(C)CCc2cc(F)ccc2O1 |
| InChI | InChI=1S/C11H13FO.C2H6/c1-11(2)6-5-8-7-9(12)3-4-10(8)13-11;1-2/h3-4,7H,5-6H2,1-2H3;1-2H3 |
| InChIKey | ZIRFAWSLZCAMFQ-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.29 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |