C11H13ClO — CID 11769444
6-chloro-2,2-dimethyl-3,4-dihydrochromene (PubChem CID 11769444) has the molecular formula C11H13ClO and a molecular weight of 196.68 g/mol. Its IUPAC name is 6-chloro-2,2-dimethyl-3,4-dihydrochromene.
| Compound Name | 6-chloro-2,2-dimethyl-3,4-dihydrochromene |
|---|---|
| PubChem CID | 11769444 |
| Molecular Formula | C11H13ClO |
| Molecular Weight | 196.68 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 6-chloro-2,2-dimethyl-3,4-dihydrochromene |
| SMILES | CC1(C)CCc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C11H13ClO/c1-11(2)6-5-8-7-9(12)3-4-10(8)13-11/h3-4,7H,5-6H2,1-2H3 |
| InChIKey | SRPXOPCIOVDZNI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.68 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |