C11H14ClNO — CID 84621622
7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepine (PubChem CID 84621622) has the molecular formula C11H14ClNO and a molecular weight of 211.69 g/mol. Its IUPAC name is 7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepine.
| Compound Name | 7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepine |
|---|---|
| PubChem CID | 84621622 |
| Molecular Formula | C11H14ClNO |
| Molecular Weight | 211.69 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 7-chloro-2,2-dimethyl-4,5-dihydro-3H-1,4-benzoxazepine |
| SMILES | CC1(C)CNCc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C11H14ClNO/c1-11(2)7-13-6-8-5-9(12)3-4-10(8)14-11/h3-5,13H,6-7H2,1-2H3 |
| InChIKey | AAEZKGLWGYOAHE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.69 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |